C28H24O12 — CID 132553223
1-[(2,4-dihydroxy-5-methoxycarbonyl-3,6-dimethylphenyl)methyl]-10-formyl-2,9-dihydroxy-4,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylic acid (PubChem CID 132553223) has the molecular formula C28H24O12 and a molecular weight of 552.49 g/mol. Its IUPAC name is 1-[(2,4-dihydroxy-5-methoxycarbonyl-3,6-dimethylphenyl)methyl]-10-formyl-2,9-dihydroxy-4,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylic acid.
| Compound Name | 1-[(2,4-dihydroxy-5-methoxycarbonyl-3,6-dimethylphenyl)methyl]-10-formyl-2,9-dihydroxy-4,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylic acid |
|---|---|
| PubChem CID | 132553223 |
| Molecular Formula | C28H24O12 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 1-[(2,4-dihydroxy-5-methoxycarbonyl-3,6-dimethylphenyl)methyl]-10-formyl-2,9-dihydroxy-4,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylic acid |
| SMILES | COC(=O)c1c(C)c(Cc2c(O)c(C(=O)O)c(C)c3c2Oc2c(C=O)c(O)cc(C)c2C(=O)O3)c(O)c(C)c1O |
| InChI | InChI=1S/C28H24O12/c1-9-6-16(30)15(8-29)24-17(9)28(37)40-23-11(3)18(26(34)35)22(33)14(25(23)39-24)7-13-10(2)19(27(36)38-5)21(32)12(4)20(13)31/h6,8,30-33H,7H2,1-5H3,(H,34,35) |
| InChIKey | RLAVQBCJJGLTBJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|