C17H24BClO2 — CID 132553303
2-[(2S)-2-(2-chlorophenyl)pent-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 132553303) has the molecular formula C17H24BClO2 and a molecular weight of 306.64 g/mol. Its IUPAC name is 2-[(2S)-2-(2-chlorophenyl)pent-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2S)-2-(2-chlorophenyl)pent-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132553303 |
| Molecular Formula | C17H24BClO2 |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(2S)-2-(2-chlorophenyl)pent-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC[C@H](CB1OC(C)(C)C(C)(C)O1)c1ccccc1Cl |
| InChI | InChI=1S/C17H24BClO2/c1-6-9-13(14-10-7-8-11-15(14)19)12-18-20-16(2,3)17(4,5)21-18/h6-8,10-11,13H,1,9,12H2,2-5H3/t13-/m1/s1 |
| InChIKey | DTDZIJMNQKDWDY-CYBMUJFWSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|