2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride

C8Cl2F4O2 — CID 13255340

IUPAC2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride
SMILESO=C(Cl)c1c(F)c(F)c(C(=O)Cl)c(F)c1F
InChIInChI=1S/C8Cl2F4O2/c9-7(15)1-3(11)5(13)2(8(10)16)6(14)4(1)12
InChIKeyKTJXAKJGNYCBOI-UHFFFAOYSA-N
MW274.98 g/mol
LogP3.00
Rot. Bonds2

About 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride

2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride (PubChem CID 13255340) has the molecular formula C8Cl2F4O2 and a molecular weight of 274.98 g/mol. Its IUPAC name is 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride.

Molecular Properties

Compound Name2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride
PubChem CID13255340
Molecular FormulaC8Cl2F4O2
Molecular Weight274.98 g/mol
Exact Mass273.92
IUPAC Name2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride
SMILESO=C(Cl)c1c(F)c(F)c(C(=O)Cl)c(F)c1F
InChIInChI=1S/C8Cl2F4O2/c9-7(15)1-3(11)5(13)2(8(10)16)6(14)4(1)12
InChIKeyKTJXAKJGNYCBOI-UHFFFAOYSA-N
XLogP3.00
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.98
LogP ≤ 53.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride?
The IUPAC name of 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride (CID 13255340) is 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride.
What is the SMILES notation for 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride?
The canonical SMILES for 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride is O=C(Cl)c1c(F)c(F)c(C(=O)Cl)c(F)c1F.
What is the InChIKey of 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride?
The InChIKey is KTJXAKJGNYCBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8Cl2F4O2/c9-7(15)1-3(11)5(13)2(8(10)16)6(14)4(1)12.
What are the key properties of 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride?
2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride has a molecular weight of 274.98 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetrafluorobenzene-1,4-dicarbonyl chloride is sourced from PubChem (CID 13255340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).