C21H28O3 — CID 132553688
(2R)-4-ethyl-3-hydroxy-2-[(1E,5E,8E,10E,13E)-pentadeca-1,5,8,10,13-pentaenyl]-2H-furan-5-one (PubChem CID 132553688) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2R)-4-ethyl-3-hydroxy-2-[(1E,5E,8E,10E,13E)-pentadeca-1,5,8,10,13-pentaenyl]-2H-furan-5-one.
| Compound Name | (2R)-4-ethyl-3-hydroxy-2-[(1E,5E,8E,10E,13E)-pentadeca-1,5,8,10,13-pentaenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 132553688 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (2R)-4-ethyl-3-hydroxy-2-[(1E,5E,8E,10E,13E)-pentadeca-1,5,8,10,13-pentaenyl]-2H-furan-5-one |
| SMILES | C/C=C/C/C=C/C=C/C/C=C/CC/C=C/[C@H]1OC(=O)C(CC)=C1O |
| InChI | InChI=1S/C21H28O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-20(22)18(4-2)21(23)24-19/h3,5,7-10,12-13,16-17,19,22H,4,6,11,14-15H2,1-2H3/b5-3+,8-7+,10-9+,13-12+,17-16+/t19-/m1/s1 |
| InChIKey | DWJYWPQKEIYTSH-FGOVEZKHSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|