C21H21NO3 — CID 132553693
(3,4-dimethoxyphenyl)-(7-phenyl-2,3-dihydroazepin-1-yl)methanone (PubChem CID 132553693) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(7-phenyl-2,3-dihydroazepin-1-yl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(7-phenyl-2,3-dihydroazepin-1-yl)methanone |
|---|---|
| PubChem CID | 132553693 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(7-phenyl-2,3-dihydroazepin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC=CC=C2c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H21NO3/c1-24-19-13-12-17(15-20(19)25-2)21(23)22-14-8-4-7-11-18(22)16-9-5-3-6-10-16/h3-7,9-13,15H,8,14H2,1-2H3 |
| InChIKey | ZUMCBUDWGUIXFO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |