C17H28O4Si — CID 132553834
(4R,7R,8S,9R,11S)-11-hydroxy-9-methyl-8-triethylsilyloxy-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one (PubChem CID 132553834) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (4R,7R,8S,9R,11S)-11-hydroxy-9-methyl-8-triethylsilyloxy-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one.
| Compound Name | (4R,7R,8S,9R,11S)-11-hydroxy-9-methyl-8-triethylsilyloxy-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one |
|---|---|
| PubChem CID | 132553834 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4R,7R,8S,9R,11S)-11-hydroxy-9-methyl-8-triethylsilyloxy-3-oxatricyclo[5.3.1.04,11]undec-1(10)-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](C)C=C2C(=O)O[C@@H]3CC[C@H]1[C@]23O |
| InChI | InChI=1S/C17H28O4Si/c1-5-22(6-2,7-3)21-15-11(4)10-13-16(18)20-14-9-8-12(15)17(13,14)19/h10-12,14-15,19H,5-9H2,1-4H3/t11-,12-,14-,15+,17+/m1/s1 |
| InChIKey | OIAVRQVYDPNNPT-BOGLJMFRSA-N |
| XLogP | 3.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|