C18H19Cl2NO2S — CID 132554336
2-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-3-propylaziridine (PubChem CID 132554336) has the molecular formula C18H19Cl2NO2S and a molecular weight of 384.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-3-propylaziridine.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-3-propylaziridine |
|---|---|
| PubChem CID | 132554336 |
| Molecular Formula | C18H19Cl2NO2S |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-3-propylaziridine |
| SMILES | CCCC1C(c2ccc(Cl)cc2Cl)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19Cl2NO2S/c1-3-4-17-18(15-10-7-13(19)11-16(15)20)21(17)24(22,23)14-8-5-12(2)6-9-14/h5-11,17-18H,3-4H2,1-2H3 |
| InChIKey | LVUJSTJGBPFXFH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|