C20H24O5 — CID 132554805
[(4S,4aR,5S)-2-hydroxy-3,4a,5-trimethyl-7-oxo-2,4,5,6-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 132554805) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(4S,4aR,5S)-2-hydroxy-3,4a,5-trimethyl-7-oxo-2,4,5,6-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4S,4aR,5S)-2-hydroxy-3,4a,5-trimethyl-7-oxo-2,4,5,6-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 132554805 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(4S,4aR,5S)-2-hydroxy-3,4a,5-trimethyl-7-oxo-2,4,5,6-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1C2=C(C)C(O)OC2=CC2=CC(=O)C[C@H](C)[C@]21C |
| InChI | InChI=1S/C20H24O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-15(16)9-13-8-14(21)7-11(3)20(13,17)5/h6,8-9,11,17,19,23H,7H2,1-5H3/b10-6-/t11-,17+,19?,20+/m0/s1 |
| InChIKey | XJOBFJHLSSCXFO-LVGCFLENSA-N |
| XLogP | 2.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|