C13H17FOS — CID 132554967
2-(2,2-dimethylpropylsulfanylmethyl)benzoyl fluoride (PubChem CID 132554967) has the molecular formula C13H17FOS and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylsulfanylmethyl)benzoyl fluoride.
| Compound Name | 2-(2,2-dimethylpropylsulfanylmethyl)benzoyl fluoride |
|---|---|
| PubChem CID | 132554967 |
| Molecular Formula | C13H17FOS |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(2,2-dimethylpropylsulfanylmethyl)benzoyl fluoride |
| SMILES | CC(C)(C)CSCc1ccccc1C(=O)F |
| InChI | InChI=1S/C13H17FOS/c1-13(2,3)9-16-8-10-6-4-5-7-11(10)12(14)15/h4-7H,8-9H2,1-3H3 |
| InChIKey | ORJIQTRGIBYOAA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|