C14H24FNO5 — CID 132555046
tert-butyl (3aR,7S,7aR)-7-fluoro-7-(hydroxymethyl)-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 132555046) has the molecular formula C14H24FNO5 and a molecular weight of 305.35 g/mol. Its IUPAC name is tert-butyl (3aR,7S,7aR)-7-fluoro-7-(hydroxymethyl)-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aR,7S,7aR)-7-fluoro-7-(hydroxymethyl)-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 132555046 |
| Molecular Formula | C14H24FNO5 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl (3aR,7S,7aR)-7-fluoro-7-(hydroxymethyl)-2,2-dimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2OC(C)(C)O[C@H]2[C@@](F)(CO)C1 |
| InChI | InChI=1S/C14H24FNO5/c1-12(2,3)21-11(18)16-6-9-10(14(15,7-16)8-17)20-13(4,5)19-9/h9-10,17H,6-8H2,1-5H3/t9-,10-,14+/m1/s1 |
| InChIKey | MIKBGINZAOVUPT-RULNRJAQSA-N |
| XLogP | 1.46 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |