About 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol
4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol (PubChem CID 132555239) has the molecular formula C17H17N3O4
and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol |
| PubChem CID | 132555239 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCn2cc(Cc3ccc(O)c(O)c3)nn2)cc1O |
| InChI | InChI=1S/C17H17N3O4/c21-14-3-1-11(8-16(14)23)5-6-20-10-13(18-19-20)7-12-2-4-15(22)17(24)9-12/h1-4,8-10,21-24H,5-7H2 |
| InChIKey | QSCOAVUWFMQZKQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol?
The IUPAC name of 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol (CID 132555239) is 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol?
The canonical SMILES for 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol is Oc1ccc(CCn2cc(Cc3ccc(O)c(O)c3)nn2)cc1O.
What is the InChIKey of 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol?
The InChIKey is QSCOAVUWFMQZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4/c21-14-3-1-11(8-16(14)23)5-6-20-10-13(18-19-20)7-12-2-4-15(22)17(24)9-12/h1-4,8-10,21-24H,5-7H2.
What are the key properties of 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol?
4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol has a molecular weight of 327.34 g/mol, XLogP of 1.93, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[(3,4-dihydroxyphenyl)methyl]triazol-1-yl]ethyl]benzene-1,2-diol is sourced from PubChem (CID 132555239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).