About 4-amino-3,5-dichloro-1H-pyridin-2-one
4-amino-3,5-dichloro-1H-pyridin-2-one (PubChem CID 13255534) has the molecular formula C5H4Cl2N2O
and a molecular weight of 179.01 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-amino-3,5-dichloro-1H-pyridin-2-one |
| PubChem CID | 13255534 |
| Molecular Formula | C5H4Cl2N2O |
| Molecular Weight | 179.01 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | 4-amino-3,5-dichloro-1H-pyridin-2-one |
| SMILES | Nc1c(Cl)c[nH]c(=O)c1Cl |
| InChI | InChI=1S/C5H4Cl2N2O/c6-2-1-9-5(10)3(7)4(2)8/h1H,(H3,8,9,10) |
| InChIKey | BDUMSBSZPZADLU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.01 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-3,5-dichloro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dichloro-1H-pyridin-2-one?
The IUPAC name of 4-amino-3,5-dichloro-1H-pyridin-2-one (CID 13255534) is 4-amino-3,5-dichloro-1H-pyridin-2-one.
What is the SMILES notation for 4-amino-3,5-dichloro-1H-pyridin-2-one?
The canonical SMILES for 4-amino-3,5-dichloro-1H-pyridin-2-one is Nc1c(Cl)c[nH]c(=O)c1Cl.
What is the InChIKey of 4-amino-3,5-dichloro-1H-pyridin-2-one?
The InChIKey is BDUMSBSZPZADLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2N2O/c6-2-1-9-5(10)3(7)4(2)8/h1H,(H3,8,9,10).
What are the key properties of 4-amino-3,5-dichloro-1H-pyridin-2-one?
4-amino-3,5-dichloro-1H-pyridin-2-one has a molecular weight of 179.01 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dichloro-1H-pyridin-2-one is sourced from PubChem (CID 13255534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).