About N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine
N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine (PubChem CID 13255550) has the molecular formula C11H13N5
and a molecular weight of 215.26 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine |
| PubChem CID | 13255550 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine |
| SMILES | Cn1ncc2ccc(NC3=NCCN3)cc21 |
| InChI | InChI=1S/C11H13N5/c1-16-10-6-9(3-2-8(10)7-14-16)15-11-12-4-5-13-11/h2-3,6-7H,4-5H2,1H3,(H2,12,13,15) |
| InChIKey | LGYHEENGOFOJSZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine (CID 13255550) is N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine is Cn1ncc2ccc(NC3=NCCN3)cc21.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine?
The InChIKey is LGYHEENGOFOJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5/c1-16-10-6-9(3-2-8(10)7-14-16)15-11-12-4-5-13-11/h2-3,6-7H,4-5H2,1H3,(H2,12,13,15).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine?
N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine has a molecular weight of 215.26 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylindazol-6-amine is sourced from PubChem (CID 13255550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).