C20H38N6 — CID 132555640
2-[(14R)-4-(cyanomethyl)-5,5,7,12,12,14-hexamethyl-1,4,7,11-tetrazacyclotetradec-1-yl]acetonitrile (PubChem CID 132555640) has the molecular formula C20H38N6 and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-[(14R)-4-(cyanomethyl)-5,5,7,12,12,14-hexamethyl-1,4,7,11-tetrazacyclotetradec-1-yl]acetonitrile.
| Compound Name | 2-[(14R)-4-(cyanomethyl)-5,5,7,12,12,14-hexamethyl-1,4,7,11-tetrazacyclotetradec-1-yl]acetonitrile |
|---|---|
| PubChem CID | 132555640 |
| Molecular Formula | C20H38N6 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2-[(14R)-4-(cyanomethyl)-5,5,7,12,12,14-hexamethyl-1,4,7,11-tetrazacyclotetradec-1-yl]acetonitrile |
| SMILES | C[C@@H]1CC(C)(C)NCCCN(C)CC(C)(C)N(CC#N)CCN1CC#N |
| InChI | InChI=1S/C20H38N6/c1-18-16-19(2,3)23-10-7-11-24(6)17-20(4,5)26(13-9-22)15-14-25(18)12-8-21/h18,23H,7,10-17H2,1-6H3/t18-/m1/s1 |
| InChIKey | DWWPBTDAOXFQLI-GOSISDBHSA-N |
| XLogP | 1.90 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|