C18H28O2 — CID 132556361
[3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxiran-2-yl]methanol (PubChem CID 132556361) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxiran-2-yl]methanol.
| Compound Name | [3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 132556361 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [3-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]oxiran-2-yl]methanol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC1OC1CO |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(16-19)20-17/h3-4,6-7,9-10,12-13,17-19H,2,5,8,11,14-16H2,1H3/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | ORVXNXIGPCLOID-LTKCOYKYSA-N |
| XLogP | 4.33 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|