C24H49IO3Si2 — CID 132556391
tert-butyl-[(E,2R,3R,4S)-2-[(4S)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]-6-iodo-4-methylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 132556391) has the molecular formula C24H49IO3Si2 and a molecular weight of 568.73 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R,4S)-2-[(4S)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]-6-iodo-4-methylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R,4S)-2-[(4S)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]-6-iodo-4-methylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 132556391 |
| Molecular Formula | C24H49IO3Si2 |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | tert-butyl-[(E,2R,3R,4S)-2-[(4S)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]-6-iodo-4-methylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/I)[C@@H]1CCO[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C24H49IO3Si2/c1-18(14-16-25)21(28-29(12,13)22(3,4)5)19(2)20-15-17-26-30(27-20,23(6,7)8)24(9,10)11/h14,16,18-21H,15,17H2,1-13H3/b16-14+/t18-,19+,20-,21+/m0/s1 |
| InChIKey | SWVZWVCMSNVXIO-IGVISXBZSA-N |
| XLogP | 8.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|