C24H31NOS — CID 132556645
(1R,2S,3R,4S)-1,7,7-trimethyl-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]bicyclo[2.2.1]heptan-2-ol (PubChem CID 132556645) has the molecular formula C24H31NOS and a molecular weight of 381.59 g/mol. Its IUPAC name is (1R,2S,3R,4S)-1,7,7-trimethyl-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,3R,4S)-1,7,7-trimethyl-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 132556645 |
| Molecular Formula | C24H31NOS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1R,2S,3R,4S)-1,7,7-trimethyl-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]bicyclo[2.2.1]heptan-2-ol |
| SMILES | Cc1ccc(Sc2ccccc2CN[C@@H]2[C@H]3CC[C@@](C)([C@@H]2O)C3(C)C)cc1 |
| InChI | InChI=1S/C24H31NOS/c1-16-9-11-18(12-10-16)27-20-8-6-5-7-17(20)15-25-21-19-13-14-24(4,22(21)26)23(19,2)3/h5-12,19,21-22,25-26H,13-15H2,1-4H3/t19-,21-,22-,24+/m1/s1 |
| InChIKey | WCVCEQFCKPZTMZ-YJRNTSOCSA-N |
| XLogP | 5.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |