C22H27N5O — CID 132557093
2-N,4-N-bis(3,5-dimethylphenyl)-6-methoxy-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 132557093) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-N,4-N-bis(3,5-dimethylphenyl)-6-methoxy-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3,5-dimethylphenyl)-6-methoxy-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 132557093 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-N,4-N-bis(3,5-dimethylphenyl)-6-methoxy-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N(C)c2cc(C)cc(C)c2)nc(N(C)c2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C22H27N5O/c1-14-8-15(2)11-18(10-14)26(5)20-23-21(25-22(24-20)28-7)27(6)19-12-16(3)9-17(4)13-19/h8-13H,1-7H3 |
| InChIKey | TUFPQRVASYWWLD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |