C20H26O7 — CID 132557276
2-(2-benzyl-1-ethoxy-1,3-dioxobutan-2-yl)oxycarbonyl-2-ethylbutanoic acid (PubChem CID 132557276) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-(2-benzyl-1-ethoxy-1,3-dioxobutan-2-yl)oxycarbonyl-2-ethylbutanoic acid.
| Compound Name | 2-(2-benzyl-1-ethoxy-1,3-dioxobutan-2-yl)oxycarbonyl-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 132557276 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(2-benzyl-1-ethoxy-1,3-dioxobutan-2-yl)oxycarbonyl-2-ethylbutanoic acid |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC(=O)C(CC)(CC)C(=O)O)C(C)=O |
| InChI | InChI=1S/C20H26O7/c1-5-19(6-2,16(22)23)17(24)27-20(14(4)21,18(25)26-7-3)13-15-11-9-8-10-12-15/h8-12H,5-7,13H2,1-4H3,(H,22,23) |
| InChIKey | IABISJBULMKMOO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|