C20H20O4 — CID 132557405
(6S,6aR,7S,10aR)-6-hydroxy-7-(2-methoxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one (PubChem CID 132557405) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (6S,6aR,7S,10aR)-6-hydroxy-7-(2-methoxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one.
| Compound Name | (6S,6aR,7S,10aR)-6-hydroxy-7-(2-methoxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one |
|---|---|
| PubChem CID | 132557405 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (6S,6aR,7S,10aR)-6-hydroxy-7-(2-methoxyphenyl)-6,6a,7,8,10,10a-hexahydrobenzo[c]chromen-9-one |
| SMILES | COc1ccccc1[C@H]1CC(=O)C[C@H]2c3ccccc3O[C@H](O)[C@H]12 |
| InChI | InChI=1S/C20H20O4/c1-23-17-8-4-2-6-13(17)15-10-12(21)11-16-14-7-3-5-9-18(14)24-20(22)19(15)16/h2-9,15-16,19-20,22H,10-11H2,1H3/t15-,16+,19-,20+/m1/s1 |
| InChIKey | BWXLQSGZHBISNR-GJJHYRHESA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |