C16H28O4 — CID 132558134
ethyl (E,4R)-4-[(1R)-1-hydroxy-2-oxopropyl]undec-2-enoate (PubChem CID 132558134) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(1R)-1-hydroxy-2-oxopropyl]undec-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(1R)-1-hydroxy-2-oxopropyl]undec-2-enoate |
|---|---|
| PubChem CID | 132558134 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethyl (E,4R)-4-[(1R)-1-hydroxy-2-oxopropyl]undec-2-enoate |
| SMILES | CCCCCCC[C@H](/C=C/C(=O)OCC)[C@@H](O)C(C)=O |
| InChI | InChI=1S/C16H28O4/c1-4-6-7-8-9-10-14(16(19)13(3)17)11-12-15(18)20-5-2/h11-12,14,16,19H,4-10H2,1-3H3/b12-11+/t14-,16+/m1/s1 |
| InChIKey | FDRYHJZJZAXMGZ-YQNRRXMVSA-N |
| XLogP | 3.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|