About 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile
3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile (PubChem CID 132558228) has the molecular formula C16H17F3N2O
and a molecular weight of 310.32 g/mol. Its IUPAC name is 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile |
| PubChem CID | 132558228 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile |
| SMILES | CN1C(=O)C(C)(CC(C)(C)C#N)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H17F3N2O/c1-14(2,9-20)8-15(3)11-7-10(16(17,18)19)5-6-12(11)21(4)13(15)22/h5-7H,8H2,1-4H3 |
| InChIKey | UWCOJILZBQQZAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile?
The IUPAC name of 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile (CID 132558228) is 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile is CN1C(=O)C(C)(CC(C)(C)C#N)c2cc(C(F)(F)F)ccc21.
What is the InChIKey of 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile?
The InChIKey is UWCOJILZBQQZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N2O/c1-14(2,9-20)8-15(3)11-7-10(16(17,18)19)5-6-12(11)21(4)13(15)22/h5-7H,8H2,1-4H3.
What are the key properties of 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile?
3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile has a molecular weight of 310.32 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-dimethyl-2-oxo-5-(trifluoromethyl)indol-3-yl]-2,2-dimethylpropanenitrile is sourced from PubChem (CID 132558228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).