About 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile
3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile (PubChem CID 132558232) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile |
| PubChem CID | 132558232 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile |
| SMILES | CN1C(=O)C(C)(CC(C)(C)C#N)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C19H26N2O/c1-17(2,3)13-8-9-15-14(10-13)19(6,16(22)21(15)7)11-18(4,5)12-20/h8-10H,11H2,1-7H3 |
| InChIKey | OZOGMKDXZXQHBL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile?
The IUPAC name of 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile (CID 132558232) is 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile is CN1C(=O)C(C)(CC(C)(C)C#N)c2cc(C(C)(C)C)ccc21.
What is the InChIKey of 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile?
The InChIKey is OZOGMKDXZXQHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-17(2,3)13-8-9-15-14(10-13)19(6,16(22)21(15)7)11-18(4,5)12-20/h8-10H,11H2,1-7H3.
What are the key properties of 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile?
3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile has a molecular weight of 298.43 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)-2,2-dimethylpropanenitrile is sourced from PubChem (CID 132558232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).