C33H40BF3N2 — CID 132558488
1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazaborole (PubChem CID 132558488) has the molecular formula C33H40BF3N2 and a molecular weight of 532.50 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazaborole.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazaborole |
|---|---|
| PubChem CID | 132558488 |
| Molecular Formula | C33H40BF3N2 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3,2-diazaborole |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)B1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H40BF3N2/c1-21(2)27-11-9-12-28(22(3)4)31(27)38-19-20-39(32-29(23(5)6)13-10-14-30(32)24(7)8)34(38)26-17-15-25(16-18-26)33(35,36)37/h9-24H,1-8H3 |
| InChIKey | DYFYDQDCVBNJBO-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|