About (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one
(4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one (PubChem CID 132558694) has the molecular formula C26H32O3
and a molecular weight of 392.54 g/mol. Its IUPAC name is (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
| PubChem CID | 132558694 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
| SMILES | CCCCCC[C@H]1CC(=O)CC12OCC(c1ccccc1)(c1ccccc1)CO2 |
| InChI | InChI=1S/C26H32O3/c1-2-3-4-7-16-23-17-24(27)18-26(23)28-19-25(20-29-26,21-12-8-5-9-13-21)22-14-10-6-11-15-22/h5-6,8-15,23H,2-4,7,16-20H2,1H3/t23-/m0/s1 |
| InChIKey | UCTGNKGFTLGESJ-QHCPKHFHSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one?
The IUPAC name of (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one (CID 132558694) is (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one.
What is the SMILES notation for (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one?
The canonical SMILES for (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one is CCCCCC[C@H]1CC(=O)CC12OCC(c1ccccc1)(c1ccccc1)CO2.
What is the InChIKey of (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one?
The InChIKey is UCTGNKGFTLGESJ-QHCPKHFHSA-N. The full InChI is InChI=1S/C26H32O3/c1-2-3-4-7-16-23-17-24(27)18-26(23)28-19-25(20-29-26,21-12-8-5-9-13-21)22-14-10-6-11-15-22/h5-6,8-15,23H,2-4,7,16-20H2,1H3/t23-/m0/s1.
What are the key properties of (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one?
(4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one has a molecular weight of 392.54 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-hexyl-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one is sourced from PubChem (CID 132558694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).