C26H31ClO3 — CID 132558695
(4S)-4-(6-chlorohexyl)-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one (PubChem CID 132558695) has the molecular formula C26H31ClO3 and a molecular weight of 426.98 g/mol. Its IUPAC name is (4S)-4-(6-chlorohexyl)-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-(6-chlorohexyl)-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 132558695 |
| Molecular Formula | C26H31ClO3 |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (4S)-4-(6-chlorohexyl)-8,8-diphenyl-6,10-dioxaspiro[4.5]decan-2-one |
| SMILES | O=C1C[C@H](CCCCCCCl)C2(C1)OCC(c1ccccc1)(c1ccccc1)CO2 |
| InChI | InChI=1S/C26H31ClO3/c27-16-10-2-1-5-15-23-17-24(28)18-26(23)29-19-25(20-30-26,21-11-6-3-7-12-21)22-13-8-4-9-14-22/h3-4,6-9,11-14,23H,1-2,5,10,15-20H2/t23-/m0/s1 |
| InChIKey | GNSSEOAUSLTSEN-QHCPKHFHSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|