C26H34O3Si — CID 132558696
(4S)-8,8-diphenyl-4-(3-trimethylsilylpropyl)-6,10-dioxaspiro[4.5]decan-2-one (PubChem CID 132558696) has the molecular formula C26H34O3Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (4S)-8,8-diphenyl-4-(3-trimethylsilylpropyl)-6,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (4S)-8,8-diphenyl-4-(3-trimethylsilylpropyl)-6,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 132558696 |
| Molecular Formula | C26H34O3Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (4S)-8,8-diphenyl-4-(3-trimethylsilylpropyl)-6,10-dioxaspiro[4.5]decan-2-one |
| SMILES | C[Si](C)(C)CCC[C@H]1CC(=O)CC12OCC(c1ccccc1)(c1ccccc1)CO2 |
| InChI | InChI=1S/C26H34O3Si/c1-30(2,3)16-10-15-23-17-24(27)18-26(23)28-19-25(20-29-26,21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-9,11-14,23H,10,15-20H2,1-3H3/t23-/m0/s1 |
| InChIKey | IBZVKBBWCNOZJR-QHCPKHFHSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|