About dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate
dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate (PubChem CID 132558708) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate.
Molecular Properties
| Compound Name | dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate |
| PubChem CID | 132558708 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate |
| SMILES | CCCC/C(=C\C=C\C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O4/c1-4-5-7-10(12(14)16-3)8-6-9-11(13)15-2/h6,8-9H,4-5,7H2,1-3H3/b9-6+,10-8+ |
| InChIKey | HZZMTGDICUUICG-OAMUUVBCSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate?
The IUPAC name of dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate (CID 132558708) is dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate.
What is the SMILES notation for dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate?
The canonical SMILES for dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate is CCCC/C(=C\C=C\C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate?
The InChIKey is HZZMTGDICUUICG-OAMUUVBCSA-N. The full InChI is InChI=1S/C12H18O4/c1-4-5-7-10(12(14)16-3)8-6-9-11(13)15-2/h6,8-9H,4-5,7H2,1-3H3/b9-6+,10-8+.
What are the key properties of dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate?
dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate has a molecular weight of 226.27 g/mol, XLogP of 2.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2E,4E)-2-butylhexa-2,4-dienedioate is sourced from PubChem (CID 132558708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).