C18H35BO5Si — CID 132558798
ethyl (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate (PubChem CID 132558798) has the molecular formula C18H35BO5Si and a molecular weight of 370.37 g/mol. Its IUPAC name is ethyl (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate.
| Compound Name | ethyl (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 132558798 |
| Molecular Formula | C18H35BO5Si |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | ethyl (Z)-4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\CO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BO5Si/c1-11-21-15(20)12-14(13-22-25(9,10)16(2,3)4)19-23-17(5,6)18(7,8)24-19/h12H,11,13H2,1-10H3/b14-12+ |
| InChIKey | SIWBOLNJEZSEMY-WYMLVPIESA-N |
| XLogP | 4.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|