C21H29NO — CID 132558875
3-[(1E,3E,5E,7E)-3,7-dimethyl-9-methyliminonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 132558875) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-[(1E,3E,5E,7E)-3,7-dimethyl-9-methyliminonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(1E,3E,5E,7E)-3,7-dimethyl-9-methyliminonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 132558875 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3-[(1E,3E,5E,7E)-3,7-dimethyl-9-methyliminonona-1,3,5,7-tetraenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C/N=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C21H29NO/c1-16(8-7-9-17(2)13-15-22-6)10-11-19-18(3)20(23)12-14-21(19,4)5/h7-11,13,15H,12,14H2,1-6H3/b9-7+,11-10+,16-8+,17-13+,22-15+ |
| InChIKey | VIDWLGYJIADKFQ-RQXOOGMHSA-N |
| XLogP | 5.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|