C23H27N3O5S — CID 132559046
N-[6-(hydroxyamino)-6-oxohexyl]-3-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 132559046) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxohexyl]-3-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[6-(hydroxyamino)-6-oxohexyl]-3-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 132559046 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexyl]-3-[3-(2-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCCCC(=O)NO)c1 |
| InChI | InChI=1S/C23H27N3O5S/c1-31-19-11-5-4-10-18(19)26-21(28)15-32-23(26)17-9-7-8-16(14-17)22(29)24-13-6-2-3-12-20(27)25-30/h4-5,7-11,14,23,30H,2-3,6,12-13,15H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | BDPRFWIJGHARFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|