About 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine
8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine (PubChem CID 13255931) has the molecular formula C6H5ClN6O2
and a molecular weight of 228.60 g/mol. Its IUPAC name is 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine.
Molecular Properties
| Compound Name | 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine |
| PubChem CID | 13255931 |
| Molecular Formula | C6H5ClN6O2 |
| Molecular Weight | 228.60 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine |
| SMILES | Cc1nnc2c(Cl)nc([N+](=O)[O-])c(N)n12 |
| InChI | InChI=1S/C6H5ClN6O2/c1-2-10-11-5-3(7)9-6(13(14)15)4(8)12(2)5/h8H2,1H3 |
| InChIKey | HYMXUSINLRNUCR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.60 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The IUPAC name of 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine (CID 13255931) is 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine.
What is the SMILES notation for 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The canonical SMILES for 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine is Cc1nnc2c(Cl)nc([N+](=O)[O-])c(N)n12.
What is the InChIKey of 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The InChIKey is HYMXUSINLRNUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN6O2/c1-2-10-11-5-3(7)9-6(13(14)15)4(8)12(2)5/h8H2,1H3.
What are the key properties of 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine?
8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine has a molecular weight of 228.60 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyrazin-5-amine is sourced from PubChem (CID 13255931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).