C21H30N2O5 — CID 132559511
1-O-tert-butyl 3-O-ethyl 3-ethyl-2-oxo-4-propylquinoxaline-1,3-dicarboxylate (PubChem CID 132559511) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-ethyl-2-oxo-4-propylquinoxaline-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-ethyl-2-oxo-4-propylquinoxaline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 132559511 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-ethyl-2-oxo-4-propylquinoxaline-1,3-dicarboxylate |
| SMILES | CCCN1c2ccccc2N(C(=O)OC(C)(C)C)C(=O)C1(CC)C(=O)OCC |
| InChI | InChI=1S/C21H30N2O5/c1-7-14-22-15-12-10-11-13-16(15)23(19(26)28-20(4,5)6)17(24)21(22,8-2)18(25)27-9-3/h10-13H,7-9,14H2,1-6H3 |
| InChIKey | HYDUXMMYKNHTSL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|