About (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene
(2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene (PubChem CID 132559814) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene |
| PubChem CID | 132559814 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene |
| SMILES | C=C/C=C/[C@]1(CC)CCc2ccccc2O1 |
| InChI | InChI=1S/C15H18O/c1-3-5-11-15(4-2)12-10-13-8-6-7-9-14(13)16-15/h3,5-9,11H,1,4,10,12H2,2H3/b11-5+/t15-/m1/s1 |
| InChIKey | QIGOGXCCHYMNPO-IWOOQVRJSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene?
The IUPAC name of (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene (CID 132559814) is (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene.
What is the SMILES notation for (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene?
The canonical SMILES for (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene is C=C/C=C/[C@]1(CC)CCc2ccccc2O1.
What is the InChIKey of (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene?
The InChIKey is QIGOGXCCHYMNPO-IWOOQVRJSA-N. The full InChI is InChI=1S/C15H18O/c1-3-5-11-15(4-2)12-10-13-8-6-7-9-14(13)16-15/h3,5-9,11H,1,4,10,12H2,2H3/b11-5+/t15-/m1/s1.
What are the key properties of (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene?
(2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene has a molecular weight of 214.31 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1E)-buta-1,3-dienyl]-2-ethyl-3,4-dihydrochromene is sourced from PubChem (CID 132559814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).