C31H11F15N2O2 — CID 132560019
[1-methyl-5-[[1-methyl-5-(2,3,4,5,6-pentafluorobenzoyl)pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 132560019) has the molecular formula C31H11F15N2O2 and a molecular weight of 728.41 g/mol. Its IUPAC name is [1-methyl-5-[[1-methyl-5-(2,3,4,5,6-pentafluorobenzoyl)pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [1-methyl-5-[[1-methyl-5-(2,3,4,5,6-pentafluorobenzoyl)pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 132560019 |
| Molecular Formula | C31H11F15N2O2 |
| Molecular Weight | 728.41 g/mol |
| Exact Mass | 728.06 |
| IUPAC Name | [1-methyl-5-[[1-methyl-5-(2,3,4,5,6-pentafluorobenzoyl)pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | Cn1c(C(=O)c2c(F)c(F)c(F)c(F)c2F)ccc1C(c1c(F)c(F)c(F)c(F)c1F)c1ccc(C(=O)c2c(F)c(F)c(F)c(F)c2F)n1C |
| InChI | InChI=1S/C31H11F15N2O2/c1-47-7(3-5-9(47)30(49)13-17(34)23(40)28(45)24(41)18(13)35)11(12-15(32)21(38)27(44)22(39)16(12)33)8-4-6-10(48(8)2)31(50)14-19(36)25(42)29(46)26(43)20(14)37/h3-6,11H,1-2H3 |
| InChIKey | KLWQKHKSRKJRGN-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.41 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|