C12H21BN2O4 — CID 132560139
(4R,5R)-2-[(Z)-but-2-enyl]-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide (PubChem CID 132560139) has the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol. Its IUPAC name is (4R,5R)-2-[(Z)-but-2-enyl]-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-2-[(Z)-but-2-enyl]-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 132560139 |
| Molecular Formula | C12H21BN2O4 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (4R,5R)-2-[(Z)-but-2-enyl]-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
| SMILES | C/C=C\CB1O[C@@H](C(=O)N(C)C)[C@H](C(=O)N(C)C)O1 |
| InChI | InChI=1S/C12H21BN2O4/c1-6-7-8-13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h6-7,9-10H,8H2,1-5H3/b7-6-/t9-,10-/m1/s1 |
| InChIKey | GVRUVEBATBJCNW-ITMFEAPISA-N |
| XLogP | 0.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|