About 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine
2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine (PubChem CID 132560386) has the molecular formula C15H17N5O2
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine.
Molecular Properties
| Compound Name | 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine |
| PubChem CID | 132560386 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine |
| SMILES | NC(N)=NCC/C=C1\NC(=O)N(/C=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C15H17N5O2/c16-14(17)18-9-4-7-12-13(21)20(15(22)19-12)10-8-11-5-2-1-3-6-11/h1-3,5-8,10H,4,9H2,(H,19,22)(H4,16,17,18)/b10-8+,12-7- |
| InChIKey | HGBRJJUEXPFMAJ-UNXPELAGSA-N |
| XLogP | 0.76 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine?
The IUPAC name of 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine (CID 132560386) is 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine.
What is the SMILES notation for 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine?
The canonical SMILES for 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine is NC(N)=NCC/C=C1\NC(=O)N(/C=C/c2ccccc2)C1=O.
What is the InChIKey of 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine?
The InChIKey is HGBRJJUEXPFMAJ-UNXPELAGSA-N. The full InChI is InChI=1S/C15H17N5O2/c16-14(17)18-9-4-7-12-13(21)20(15(22)19-12)10-8-11-5-2-1-3-6-11/h1-3,5-8,10H,4,9H2,(H,19,22)(H4,16,17,18)/b10-8+,12-7-.
What are the key properties of 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine?
2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine has a molecular weight of 299.33 g/mol, XLogP of 0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-3-[2,5-dioxo-1-[(E)-2-phenylethenyl]imidazolidin-4-ylidene]propyl]guanidine is sourced from PubChem (CID 132560386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).