C10H8F3N3O — CID 132561257
(1S,3S)-1-azido-3-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran (PubChem CID 132561257) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is (1S,3S)-1-azido-3-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran.
| Compound Name | (1S,3S)-1-azido-3-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 132561257 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (1S,3S)-1-azido-3-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran |
| SMILES | [N-]=[N+]=N[C@H]1O[C@@H](CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C10H8F3N3O/c11-10(12,13)5-8-6-3-1-2-4-7(6)9(17-8)15-16-14/h1-4,8-9H,5H2/t8-,9-/m0/s1 |
| InChIKey | QPSUFPKBHBEIDI-IUCAKERBSA-N |
| XLogP | 4.02 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|