C20H20N6+2 — CID 132561660
4,11-dibenzyl-5,6,9,10-tetraza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 132561660) has the molecular formula C20H20N6+2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4,11-dibenzyl-5,6,9,10-tetraza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 4,11-dibenzyl-5,6,9,10-tetraza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 132561660 |
| Molecular Formula | C20H20N6+2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4,11-dibenzyl-5,6,9,10-tetraza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | c1ccc(C[n+]2cc3n(n2)CCn2n[n+](Cc4ccccc4)cc2-3)cc1 |
| InChI | InChI=1S/C20H20N6/c1-3-7-17(8-4-1)13-23-15-19-20-16-24(14-18-9-5-2-6-10-18)22-26(20)12-11-25(19)21-23/h1-10,15-16H,11-14H2/q+2 |
| InChIKey | KMNWBHDXQAWECW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|