About (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane
(6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane (PubChem CID 132561832) has the molecular formula C15H24N2OSi
and a molecular weight of 276.46 g/mol. Its IUPAC name is (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane.
Molecular Properties
| Compound Name | (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane |
| PubChem CID | 132561832 |
| Molecular Formula | C15H24N2OSi |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane |
| SMILES | CCOc1ccc2cc([Si](CC)(CC)CC)nn2c1 |
| InChI | InChI=1S/C15H24N2OSi/c1-5-18-14-10-9-13-11-15(16-17(13)12-14)19(6-2,7-3)8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | DHUUWAQOELSCQX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane?
The IUPAC name of (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane (CID 132561832) is (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane.
What is the SMILES notation for (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane?
The canonical SMILES for (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane is CCOc1ccc2cc([Si](CC)(CC)CC)nn2c1.
What is the InChIKey of (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane?
The InChIKey is DHUUWAQOELSCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OSi/c1-5-18-14-10-9-13-11-15(16-17(13)12-14)19(6-2,7-3)8-4/h9-12H,5-8H2,1-4H3.
What are the key properties of (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane?
(6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane has a molecular weight of 276.46 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethoxypyrazolo[1,5-a]pyridin-2-yl)-triethylsilane is sourced from PubChem (CID 132561832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).