C60H77O3P3S3 — CID 132562008
2-[2,2-bis[2-[bis(2-phenylethyl)phosphinothioyl]ethoxymethyl]butoxy]ethyl-bis(2-phenylethyl)-sulfanylidene-λ5-phosphane (PubChem CID 132562008) has the molecular formula C60H77O3P3S3 and a molecular weight of 1035.40 g/mol. Its IUPAC name is 2-[2,2-bis[2-[bis(2-phenylethyl)phosphinothioyl]ethoxymethyl]butoxy]ethyl-bis(2-phenylethyl)-sulfanylidene-λ5-phosphane.
| Compound Name | 2-[2,2-bis[2-[bis(2-phenylethyl)phosphinothioyl]ethoxymethyl]butoxy]ethyl-bis(2-phenylethyl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 132562008 |
| Molecular Formula | C60H77O3P3S3 |
| Molecular Weight | 1035.40 g/mol |
| Exact Mass | 1034.42 |
| IUPAC Name | 2-[2,2-bis[2-[bis(2-phenylethyl)phosphinothioyl]ethoxymethyl]butoxy]ethyl-bis(2-phenylethyl)-sulfanylidene-λ5-phosphane |
| SMILES | CCC(COCCP(=S)(CCc1ccccc1)CCc1ccccc1)(COCCP(=S)(CCc1ccccc1)CCc1ccccc1)COCCP(=S)(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C60H77O3P3S3/c1-2-60(51-61-39-48-64(67,42-33-54-21-9-3-10-22-54)43-34-55-23-11-4-12-24-55,52-62-40-49-65(68,44-35-56-25-13-5-14-26-56)45-36-57-27-15-6-16-28-57)53-63-41-50-66(69,46-37-58-29-17-7-18-30-58)47-38-59-31-19-8-20-32-59/h3-32H,2,33-53H2,1H3 |
| InChIKey | BHKOHHKROVBPKS-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.40 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|