C9H16O2S2 — CID 132562581
(8R,10R)-1,5-dithiaspiro[5.5]undecane-8,10-diol (PubChem CID 132562581) has the molecular formula C9H16O2S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (8R,10R)-1,5-dithiaspiro[5.5]undecane-8,10-diol.
| Compound Name | (8R,10R)-1,5-dithiaspiro[5.5]undecane-8,10-diol |
|---|---|
| PubChem CID | 132562581 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (8R,10R)-1,5-dithiaspiro[5.5]undecane-8,10-diol |
| SMILES | O[C@@H]1C[C@@H](O)CC2(C1)SCCCS2 |
| InChI | InChI=1S/C9H16O2S2/c10-7-4-8(11)6-9(5-7)12-2-1-3-13-9/h7-8,10-11H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | YQIAEVNZOHSCPD-HTQZYQBOSA-N |
| XLogP | 1.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |