C23H15N3O2 — CID 132563056
(2S,3S)-1-(1,3-dioxoisoindol-2-yl)-2,3-diphenylaziridine-2-carbonitrile (PubChem CID 132563056) has the molecular formula C23H15N3O2 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S,3S)-1-(1,3-dioxoisoindol-2-yl)-2,3-diphenylaziridine-2-carbonitrile.
| Compound Name | (2S,3S)-1-(1,3-dioxoisoindol-2-yl)-2,3-diphenylaziridine-2-carbonitrile |
|---|---|
| PubChem CID | 132563056 |
| Molecular Formula | C23H15N3O2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (2S,3S)-1-(1,3-dioxoisoindol-2-yl)-2,3-diphenylaziridine-2-carbonitrile |
| SMILES | N#C[C@]1(c2ccccc2)[C@H](c2ccccc2)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H15N3O2/c24-15-23(17-11-5-2-6-12-17)20(16-9-3-1-4-10-16)26(23)25-21(27)18-13-7-8-14-19(18)22(25)28/h1-14,20H/t20-,23-,26?/m0/s1 |
| InChIKey | DKHXKAHMHJEZKC-YHBFXGCJSA-N |
| XLogP | 3.67 |
| TPSA | 64.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|