C18H24N2O6 — CID 132563526
(5,7-dimethoxy-3-oxo-1H-isoindol-2-yl) 2-[di(propan-2-yl)amino]-2-oxoacetate (PubChem CID 132563526) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is (5,7-dimethoxy-3-oxo-1H-isoindol-2-yl) 2-[di(propan-2-yl)amino]-2-oxoacetate.
| Compound Name | (5,7-dimethoxy-3-oxo-1H-isoindol-2-yl) 2-[di(propan-2-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 132563526 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (5,7-dimethoxy-3-oxo-1H-isoindol-2-yl) 2-[di(propan-2-yl)amino]-2-oxoacetate |
| SMILES | COc1cc(OC)c2c(c1)C(=O)N(OC(=O)C(=O)N(C(C)C)C(C)C)C2 |
| InChI | InChI=1S/C18H24N2O6/c1-10(2)20(11(3)4)17(22)18(23)26-19-9-14-13(16(19)21)7-12(24-5)8-15(14)25-6/h7-8,10-11H,9H2,1-6H3 |
| InChIKey | VNEGNEKSZLVCMH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|