C28H48O4Si — CID 132563768
diethyl (3aR,8aR)-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-azulene-1,1-dicarboxylate (PubChem CID 132563768) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is diethyl (3aR,8aR)-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-azulene-1,1-dicarboxylate.
| Compound Name | diethyl (3aR,8aR)-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-azulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132563768 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | diethyl (3aR,8aR)-2-[3-tri(propan-2-yl)silylprop-2-ynyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-azulene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(CC#C[Si](C(C)C)(C(C)C)C(C)C)C[C@H]2CCCCC[C@H]21 |
| InChI | InChI=1S/C28H48O4Si/c1-9-31-26(29)28(27(30)32-10-2)24(19-23-15-12-11-13-17-25(23)28)16-14-18-33(20(3)4,21(5)6)22(7)8/h20-25H,9-13,15-17,19H2,1-8H3/t23-,24?,25-/m1/s1 |
| InChIKey | LVVVOVJAPIJWQR-VSPQQOHGSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|