C19H12BrN3O2S — CID 1325639
1-(3-bromophenyl)-6-hydroxy-5-(indol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 1325639) has the molecular formula C19H12BrN3O2S and a molecular weight of 426.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-6-hydroxy-5-(indol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3-bromophenyl)-6-hydroxy-5-(indol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 1325639 |
| Molecular Formula | C19H12BrN3O2S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 1-(3-bromophenyl)-6-hydroxy-5-(indol-2-ylidenemethyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(-c2cccc(Br)c2)c(O)c1C=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C19H12BrN3O2S/c20-12-5-3-6-14(9-12)23-18(25)15(17(24)22-19(23)26)10-13-8-11-4-1-2-7-16(11)21-13/h1-10,25H,(H,22,24,26) |
| InChIKey | CONXKGIUBXUORT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|