About 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene
1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene (PubChem CID 132564143) has the molecular formula C12H9IS
and a molecular weight of 312.18 g/mol. Its IUPAC name is 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene.
Molecular Properties
| Compound Name | 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene |
| PubChem CID | 132564143 |
| Molecular Formula | C12H9IS |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene |
| SMILES | CCSC#CC#Cc1ccc(I)cc1 |
| InChI | InChI=1S/C12H9IS/c1-2-14-10-4-3-5-11-6-8-12(13)9-7-11/h6-9H,2H2,1H3 |
| InChIKey | WLOAZXVYOPMVSK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene?
The IUPAC name of 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene (CID 132564143) is 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene.
What is the SMILES notation for 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene?
The canonical SMILES for 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene is CCSC#CC#Cc1ccc(I)cc1.
What is the InChIKey of 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene?
The InChIKey is WLOAZXVYOPMVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9IS/c1-2-14-10-4-3-5-11-6-8-12(13)9-7-11/h6-9H,2H2,1H3.
What are the key properties of 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene?
1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene has a molecular weight of 312.18 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylsulfanylbuta-1,3-diynyl)-4-iodobenzene is sourced from PubChem (CID 132564143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).