About 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine
2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine (PubChem CID 132565110) has the molecular formula C13H26N3+
and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine |
| PubChem CID | 132565110 |
| Molecular Formula | C13H26N3+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine |
| SMILES | CCCC[n+]1ccn(CCN(CC)CC)c1 |
| InChI | InChI=1S/C13H26N3/c1-4-7-8-15-11-12-16(13-15)10-9-14(5-2)6-3/h11-13H,4-10H2,1-3H3/q+1 |
| InChIKey | JADAEPPLYNYXNX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine?
The IUPAC name of 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine (CID 132565110) is 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine?
The canonical SMILES for 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine is CCCC[n+]1ccn(CCN(CC)CC)c1.
What is the InChIKey of 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine?
The InChIKey is JADAEPPLYNYXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N3/c1-4-7-8-15-11-12-16(13-15)10-9-14(5-2)6-3/h11-13H,4-10H2,1-3H3/q+1.
What are the key properties of 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine?
2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine has a molecular weight of 224.37 g/mol, XLogP of 1.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-butylimidazol-3-ium-1-yl)-N,N-diethylethanamine is sourced from PubChem (CID 132565110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).