C27H50O5Si2 — CID 132565457
[(1S,2R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-methylprop-1-enyl)-8-oxabicyclo[3.2.1]oct-3-en-2-yl] acetate (PubChem CID 132565457) has the molecular formula C27H50O5Si2 and a molecular weight of 510.86 g/mol. Its IUPAC name is [(1S,2R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-methylprop-1-enyl)-8-oxabicyclo[3.2.1]oct-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-methylprop-1-enyl)-8-oxabicyclo[3.2.1]oct-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 132565457 |
| Molecular Formula | C27H50O5Si2 |
| Molecular Weight | 510.86 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | [(1S,2R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-methylprop-1-enyl)-8-oxabicyclo[3.2.1]oct-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C=C(C)C)=C[C@@H]2O[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O5Si2/c1-18(2)14-20-15-23-21(16-29-33(10,11)26(4,5)6)22(17-30-34(12,13)27(7,8)9)25(32-23)24(20)31-19(3)28/h14-15,21-25H,16-17H2,1-13H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | QEADGRRCEAKKKD-MQZWXTIWSA-N |
| XLogP | 6.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.86 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|