C42H36F20N2O4 — CID 132565560
4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine (PubChem CID 132565560) has the molecular formula C42H36F20N2O4 and a molecular weight of 1012.72 g/mol. Its IUPAC name is 4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine.
| Compound Name | 4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 132565560 |
| Molecular Formula | C42H36F20N2O4 |
| Molecular Weight | 1012.72 g/mol |
| Exact Mass | 1012.24 |
| IUPAC Name | 4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[3,5-bis(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)CCCOc1cc(OCCCC(F)(F)C(F)(F)F)cc(-c2ccnc(-c3cc(-c4cc(OCCCC(F)(F)C(F)(F)F)cc(OCCCC(F)(F)C(F)(F)F)c4)ccn3)c2)c1 |
| InChI | InChI=1S/C42H36F20N2O4/c43-35(44,39(51,52)53)7-1-13-65-29-17-27(18-30(23-29)66-14-2-8-36(45,46)40(54,55)56)25-5-11-63-33(21-25)34-22-26(6-12-64-34)28-19-31(67-15-3-9-37(47,48)41(57,58)59)24-32(20-28)68-16-4-10-38(49,50)42(60,61)62/h5-6,11-12,17-24H,1-4,7-10,13-16H2 |
| InChIKey | NSCXKFCQQPWFGG-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.72 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|